C13H11FO4 — CID 132506052
methyl (1S,5R,6S)-6-(4-fluorophenyl)-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate (PubChem CID 132506052) has the molecular formula C13H11FO4 and a molecular weight of 250.22 g/mol. Its IUPAC name is methyl (1S,5R,6S)-6-(4-fluorophenyl)-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate.
| Compound Name | methyl (1S,5R,6S)-6-(4-fluorophenyl)-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate |
|---|---|
| PubChem CID | 132506052 |
| Molecular Formula | C13H11FO4 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | methyl (1S,5R,6S)-6-(4-fluorophenyl)-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)OC[C@@H]1[C@H]2c1ccc(F)cc1 |
| InChI | InChI=1S/C13H11FO4/c1-17-11(15)13-9(6-18-12(13)16)10(13)7-2-4-8(14)5-3-7/h2-5,9-10H,6H2,1H3/t9-,10-,13-/m1/s1 |
| InChIKey | WOOAMGCIVQIZPD-GIPNMCIBSA-N |
| XLogP | 1.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|