C21H20O6 — CID 177491975
methyl (1S,5R,6S)-6-(3-methoxy-4-phenylmethoxyphenyl)-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate (PubChem CID 177491975) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is methyl (1S,5R,6S)-6-(3-methoxy-4-phenylmethoxyphenyl)-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate.
| Compound Name | methyl (1S,5R,6S)-6-(3-methoxy-4-phenylmethoxyphenyl)-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate |
|---|---|
| PubChem CID | 177491975 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | methyl (1S,5R,6S)-6-(3-methoxy-4-phenylmethoxyphenyl)-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)OC[C@@H]1[C@H]2c1ccc(OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C21H20O6/c1-24-17-10-14(8-9-16(17)26-11-13-6-4-3-5-7-13)18-15-12-27-20(23)21(15,18)19(22)25-2/h3-10,15,18H,11-12H2,1-2H3/t15-,18-,21-/m1/s1 |
| InChIKey | SIIKBFCJXCVZIS-FQELHTAISA-N |
| XLogP | 2.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|