C20H20O5 — CID 162399327
(4S)-4-[(R)-hydroxy-(3-methoxy-4-phenylmethoxyphenyl)methyl]-3-methylideneoxolan-2-one (PubChem CID 162399327) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is (4S)-4-[(R)-hydroxy-(3-methoxy-4-phenylmethoxyphenyl)methyl]-3-methylideneoxolan-2-one.
| Compound Name | (4S)-4-[(R)-hydroxy-(3-methoxy-4-phenylmethoxyphenyl)methyl]-3-methylideneoxolan-2-one |
|---|---|
| PubChem CID | 162399327 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (4S)-4-[(R)-hydroxy-(3-methoxy-4-phenylmethoxyphenyl)methyl]-3-methylideneoxolan-2-one |
| SMILES | C=C1C(=O)OC[C@H]1[C@@H](O)c1ccc(OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C20H20O5/c1-13-16(12-25-20(13)22)19(21)15-8-9-17(18(10-15)23-2)24-11-14-6-4-3-5-7-14/h3-10,16,19,21H,1,11-12H2,2H3/t16-,19+/m1/s1 |
| InChIKey | KMUZKDQQUSTSEO-APWZRJJASA-N |
| XLogP | 3.04 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|