C18H14O3 — CID 122391970
(1S,5R,6S)-1-benzoyl-6-phenyl-3-oxabicyclo[3.1.0]hexan-2-one (PubChem CID 122391970) has the molecular formula C18H14O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is (1S,5R,6S)-1-benzoyl-6-phenyl-3-oxabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1S,5R,6S)-1-benzoyl-6-phenyl-3-oxabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 122391970 |
| Molecular Formula | C18H14O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | (1S,5R,6S)-1-benzoyl-6-phenyl-3-oxabicyclo[3.1.0]hexan-2-one |
| SMILES | O=C1OC[C@@H]2[C@@H](c3ccccc3)[C@]12C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H14O3/c19-16(13-9-5-2-6-10-13)18-14(11-21-17(18)20)15(18)12-7-3-1-4-8-12/h1-10,14-15H,11H2/t14-,15-,18-/m1/s1 |
| InChIKey | YHJQKGRKEMBZCJ-IIDMSEBBSA-N |
| XLogP | 2.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|