C15H14O2 — CID 10513426
(1S,5R,6R)-6-ethenyl-1-[(E)-2-phenylethenyl]-3-oxabicyclo[3.1.0]hexan-2-one (PubChem CID 10513426) has the molecular formula C15H14O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is (1S,5R,6R)-6-ethenyl-1-[(E)-2-phenylethenyl]-3-oxabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1S,5R,6R)-6-ethenyl-1-[(E)-2-phenylethenyl]-3-oxabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 10513426 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (1S,5R,6R)-6-ethenyl-1-[(E)-2-phenylethenyl]-3-oxabicyclo[3.1.0]hexan-2-one |
| SMILES | C=C[C@@H]1[C@H]2COC(=O)[C@@]12/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H14O2/c1-2-12-13-10-17-14(16)15(12,13)9-8-11-6-4-3-5-7-11/h2-9,12-13H,1,10H2/b9-8+/t12-,13-,15+/m1/s1 |
| InChIKey | FKSYLSZMSCJBMT-SYFVHKBXSA-N |
| XLogP | 2.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|