C21H21NO2 — CID 11461333
(4R)-3-[(1R)-1-phenylbut-3-enyl]-4-[(E)-2-phenylethenyl]-1,3-oxazolidin-2-one (PubChem CID 11461333) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is (4R)-3-[(1R)-1-phenylbut-3-enyl]-4-[(E)-2-phenylethenyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(1R)-1-phenylbut-3-enyl]-4-[(E)-2-phenylethenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11461333 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (4R)-3-[(1R)-1-phenylbut-3-enyl]-4-[(E)-2-phenylethenyl]-1,3-oxazolidin-2-one |
| SMILES | C=CC[C@H](c1ccccc1)N1C(=O)OC[C@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C21H21NO2/c1-2-9-20(18-12-7-4-8-13-18)22-19(16-24-21(22)23)15-14-17-10-5-3-6-11-17/h2-8,10-15,19-20H,1,9,16H2/b15-14+/t19-,20-/m1/s1 |
| InChIKey | MWTBBQSERZGTSH-ICQOZSIZSA-N |
| XLogP | 4.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|