C16H16O2 — CID 101007824
(1R,5R,6R)-1-[(E)-2-phenylethenyl]-6-[(E)-prop-1-enyl]-3-oxabicyclo[3.1.0]hexan-2-one (PubChem CID 101007824) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is (1R,5R,6R)-1-[(E)-2-phenylethenyl]-6-[(E)-prop-1-enyl]-3-oxabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1R,5R,6R)-1-[(E)-2-phenylethenyl]-6-[(E)-prop-1-enyl]-3-oxabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 101007824 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | (1R,5R,6R)-1-[(E)-2-phenylethenyl]-6-[(E)-prop-1-enyl]-3-oxabicyclo[3.1.0]hexan-2-one |
| SMILES | C/C=C/[C@@H]1[C@H]2COC(=O)[C@]12/C=C/c1ccccc1 |
| InChI | InChI=1S/C16H16O2/c1-2-6-13-14-11-18-15(17)16(13,14)10-9-12-7-4-3-5-8-12/h2-10,13-14H,11H2,1H3/b6-2+,10-9+/t13-,14-,16-/m1/s1 |
| InChIKey | HXOQXVSHOYHVMO-JPFPXNRASA-N |
| XLogP | 3.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|