C15H13CsO3 — CID 154711262
cesium (1R,2R,6R)-2-methyl-5-oxo-6-[(E)-2-phenylethenyl]-7-oxabicyclo[4.1.0]hept-3-en-2-olate (PubChem CID 154711262) has the molecular formula C15H13CsO3 and a molecular weight of 374.17 g/mol. Its IUPAC name is cesium (1R,2R,6R)-2-methyl-5-oxo-6-[(E)-2-phenylethenyl]-7-oxabicyclo[4.1.0]hept-3-en-2-olate.
| Compound Name | cesium (1R,2R,6R)-2-methyl-5-oxo-6-[(E)-2-phenylethenyl]-7-oxabicyclo[4.1.0]hept-3-en-2-olate |
|---|---|
| PubChem CID | 154711262 |
| Molecular Formula | C15H13CsO3 |
| Molecular Weight | 374.17 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | cesium (1R,2R,6R)-2-methyl-5-oxo-6-[(E)-2-phenylethenyl]-7-oxabicyclo[4.1.0]hept-3-en-2-olate |
| SMILES | C[C@@]1([O-])C=CC(=O)[C@]2(/C=C/c3ccccc3)O[C@@H]21.[Cs+] |
| InChI | InChI=1S/C15H13O3.Cs/c1-14(17)9-8-12(16)15(13(14)18-15)10-7-11-5-3-2-4-6-11;/h2-10,13H,1H3;/q-1;+1/b10-7+;/t13-,14-,15+;/m1./s1 |
| InChIKey | UBLOPZADDMYGFI-ZCYUHSGVSA-N |
| XLogP | -1.90 |
| TPSA | 52.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.17 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|