C18H17NO2 — CID 70488570
pyrrolidine-2,5-dione;stilbene (PubChem CID 70488570) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is pyrrolidine-2,5-dione;stilbene.
| Compound Name | pyrrolidine-2,5-dione;stilbene |
|---|---|
| PubChem CID | 70488570 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | pyrrolidine-2,5-dione;stilbene |
| SMILES | C(=Cc1ccccc1)c1ccccc1.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C14H12.C4H5NO2/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;6-3-1-2-4(7)5-3/h1-12H;1-2H2,(H,5,6,7) |
| InChIKey | FIOKPBAKYWRCQC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|