C15H14O2 — CID 102423593
(2R,3R)-2-[(E)-2-phenylethenyl]-5-oxaspiro[2.5]oct-7-en-4-one (PubChem CID 102423593) has the molecular formula C15H14O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is (2R,3R)-2-[(E)-2-phenylethenyl]-5-oxaspiro[2.5]oct-7-en-4-one.
| Compound Name | (2R,3R)-2-[(E)-2-phenylethenyl]-5-oxaspiro[2.5]oct-7-en-4-one |
|---|---|
| PubChem CID | 102423593 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (2R,3R)-2-[(E)-2-phenylethenyl]-5-oxaspiro[2.5]oct-7-en-4-one |
| SMILES | O=C1OCC=C[C@@]12C[C@@H]2/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H14O2/c16-14-15(9-4-10-17-14)11-13(15)8-7-12-5-2-1-3-6-12/h1-9,13H,10-11H2/b8-7+/t13-,15-/m0/s1 |
| InChIKey | VOSOYSQEZUYZHL-IZYAJXRASA-N |
| XLogP | 2.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|