C22H22O2 — CID 132549132
(E)-3-[(1S,5R,6S)-2,2-dimethyl-6-phenyl-3-oxabicyclo[3.1.0]hexan-1-yl]-1-phenylprop-2-en-1-one (PubChem CID 132549132) has the molecular formula C22H22O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is (E)-3-[(1S,5R,6S)-2,2-dimethyl-6-phenyl-3-oxabicyclo[3.1.0]hexan-1-yl]-1-phenylprop-2-en-1-one.
| Compound Name | (E)-3-[(1S,5R,6S)-2,2-dimethyl-6-phenyl-3-oxabicyclo[3.1.0]hexan-1-yl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 132549132 |
| Molecular Formula | C22H22O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (E)-3-[(1S,5R,6S)-2,2-dimethyl-6-phenyl-3-oxabicyclo[3.1.0]hexan-1-yl]-1-phenylprop-2-en-1-one |
| SMILES | CC1(C)OC[C@@H]2[C@@H](c3ccccc3)[C@@]21/C=C/C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H22O2/c1-21(2)22(14-13-19(23)16-9-5-3-6-10-16)18(15-24-21)20(22)17-11-7-4-8-12-17/h3-14,18,20H,15H2,1-2H3/b14-13+/t18-,20-,22-/m1/s1 |
| InChIKey | BKAIJTIZKFLAPG-HSFLOCSSSA-N |
| XLogP | 4.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|