C19H18Br2O — CID 132530978
(2S,3R,4R,5S)-2,5-dibromo-2,5-dimethyl-3,4-diphenylcyclopentan-1-one (PubChem CID 132530978) has the molecular formula C19H18Br2O and a molecular weight of 422.16 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2,5-dibromo-2,5-dimethyl-3,4-diphenylcyclopentan-1-one.
| Compound Name | (2S,3R,4R,5S)-2,5-dibromo-2,5-dimethyl-3,4-diphenylcyclopentan-1-one |
|---|---|
| PubChem CID | 132530978 |
| Molecular Formula | C19H18Br2O |
| Molecular Weight | 422.16 g/mol |
| Exact Mass | 419.97 |
| IUPAC Name | (2S,3R,4R,5S)-2,5-dibromo-2,5-dimethyl-3,4-diphenylcyclopentan-1-one |
| SMILES | C[C@@]1(Br)C(=O)[C@@](C)(Br)[C@@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H18Br2O/c1-18(20)15(13-9-5-3-6-10-13)16(19(2,21)17(18)22)14-11-7-4-8-12-14/h3-12,15-16H,1-2H3/t15-,16-,18-,19-/m0/s1 |
| InChIKey | VFUXSULLVYBQJO-CAMMJAKZSA-N |
| XLogP | 5.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.16 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|