C12H14Br2 — CID 23273168
[(1S,3R)-2,2-dibromo-3-propan-2-ylcyclopropyl]benzene (PubChem CID 23273168) has the molecular formula C12H14Br2 and a molecular weight of 318.05 g/mol. Its IUPAC name is [(1S,3R)-2,2-dibromo-3-propan-2-ylcyclopropyl]benzene.
| Compound Name | [(1S,3R)-2,2-dibromo-3-propan-2-ylcyclopropyl]benzene |
|---|---|
| PubChem CID | 23273168 |
| Molecular Formula | C12H14Br2 |
| Molecular Weight | 318.05 g/mol |
| Exact Mass | 315.95 |
| IUPAC Name | [(1S,3R)-2,2-dibromo-3-propan-2-ylcyclopropyl]benzene |
| SMILES | CC(C)[C@@H]1[C@@H](c2ccccc2)C1(Br)Br |
| InChI | InChI=1S/C12H14Br2/c1-8(2)10-11(12(10,13)14)9-6-4-3-5-7-9/h3-8,10-11H,1-2H3/t10-,11-/m1/s1 |
| InChIKey | UJEKXOWZXXVFPD-GHMZBOCLSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.05 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|