About (2,2-dibromo-3-cyclohexa-1,5-dien-1-ylcyclopropyl)benzene;ethane
(2,2-dibromo-3-cyclohexa-1,5-dien-1-ylcyclopropyl)benzene;ethane (PubChem CID 144612266) has the molecular formula C17H20Br2
and a molecular weight of 384.16 g/mol. Its IUPAC name is (2,2-dibromo-3-cyclohexa-1,5-dien-1-ylcyclopropyl)benzene;ethane.
Molecular Properties
| Compound Name | (2,2-dibromo-3-cyclohexa-1,5-dien-1-ylcyclopropyl)benzene;ethane |
| PubChem CID | 144612266 |
| Molecular Formula | C17H20Br2 |
| Molecular Weight | 384.16 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | (2,2-dibromo-3-cyclohexa-1,5-dien-1-ylcyclopropyl)benzene;ethane |
| SMILES | BrC1(Br)C(C2=CCCC=C2)C1c1ccccc1.CC |
| InChI | InChI=1S/C15H14Br2.C2H6/c16-15(17)13(11-7-3-1-4-8-11)14(15)12-9-5-2-6-10-12;1-2/h1,3-5,7-10,13-14H,2,6H2;1-2H3 |
| InChIKey | FKOXVSMQGNSLGP-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.16 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dibromo-3-cyclohexa-1,5-dien-1-ylcyclopropyl)benzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dibromo-3-cyclohexa-1,5-dien-1-ylcyclopropyl)benzene;ethane?
The IUPAC name of (2,2-dibromo-3-cyclohexa-1,5-dien-1-ylcyclopropyl)benzene;ethane (CID 144612266) is (2,2-dibromo-3-cyclohexa-1,5-dien-1-ylcyclopropyl)benzene;ethane.
What is the SMILES notation for (2,2-dibromo-3-cyclohexa-1,5-dien-1-ylcyclopropyl)benzene;ethane?
The canonical SMILES for (2,2-dibromo-3-cyclohexa-1,5-dien-1-ylcyclopropyl)benzene;ethane is BrC1(Br)C(C2=CCCC=C2)C1c1ccccc1.CC.
What is the InChIKey of (2,2-dibromo-3-cyclohexa-1,5-dien-1-ylcyclopropyl)benzene;ethane?
The InChIKey is FKOXVSMQGNSLGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14Br2.C2H6/c16-15(17)13(11-7-3-1-4-8-11)14(15)12-9-5-2-6-10-12;1-2/h1,3-5,7-10,13-14H,2,6H2;1-2H3.
What are the key properties of (2,2-dibromo-3-cyclohexa-1,5-dien-1-ylcyclopropyl)benzene;ethane?
(2,2-dibromo-3-cyclohexa-1,5-dien-1-ylcyclopropyl)benzene;ethane has a molecular weight of 384.16 g/mol, XLogP of 6.19, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dibromo-3-cyclohexa-1,5-dien-1-ylcyclopropyl)benzene;ethane is sourced from PubChem (CID 144612266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).