About undecan-3-ylbenzene
undecan-3-ylbenzene (PubChem CID 20655) has the molecular formula C17H28
and a molecular weight of 232.41 g/mol. Its IUPAC name is undecan-3-ylbenzene.
Molecular Properties
| Compound Name | undecan-3-ylbenzene |
| PubChem CID | 20655 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | undecan-3-ylbenzene |
| SMILES | CCCCCCCCC(CC)c1ccccc1 |
| InChI | InChI=1S/C17H28/c1-3-5-6-7-8-10-13-16(4-2)17-14-11-9-12-15-17/h9,11-12,14-16H,3-8,10,13H2,1-2H3 |
| InChIKey | NVHBFHMWJJMQTG-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze undecan-3-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undecan-3-ylbenzene?
The IUPAC name of undecan-3-ylbenzene (CID 20655) is undecan-3-ylbenzene.
What is the SMILES notation for undecan-3-ylbenzene?
The canonical SMILES for undecan-3-ylbenzene is CCCCCCCCC(CC)c1ccccc1.
What is the InChIKey of undecan-3-ylbenzene?
The InChIKey is NVHBFHMWJJMQTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28/c1-3-5-6-7-8-10-13-16(4-2)17-14-11-9-12-15-17/h9,11-12,14-16H,3-8,10,13H2,1-2H3.
What are the key properties of undecan-3-ylbenzene?
undecan-3-ylbenzene has a molecular weight of 232.41 g/mol, XLogP of 5.93, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for undecan-3-ylbenzene is sourced from PubChem (CID 20655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).