C17H16Br2 — CID 102136520
[(1R,2S)-4,4-dibromo-2-phenylcyclopentyl]benzene (PubChem CID 102136520) has the molecular formula C17H16Br2 and a molecular weight of 380.12 g/mol. Its IUPAC name is [(1R,2S)-4,4-dibromo-2-phenylcyclopentyl]benzene.
| Compound Name | [(1R,2S)-4,4-dibromo-2-phenylcyclopentyl]benzene |
|---|---|
| PubChem CID | 102136520 |
| Molecular Formula | C17H16Br2 |
| Molecular Weight | 380.12 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | [(1R,2S)-4,4-dibromo-2-phenylcyclopentyl]benzene |
| SMILES | BrC1(Br)C[C@H](c2ccccc2)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C17H16Br2/c18-17(19)11-15(13-7-3-1-4-8-13)16(12-17)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2/t15-,16+ |
| InChIKey | GNFHANPZPLNDLC-IYBDPMFKSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.12 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|