C18H21N — CID 131847538
(3R,4R)-2,2-dimethyl-3,4-diphenylpyrrolidine (PubChem CID 131847538) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is (3R,4R)-2,2-dimethyl-3,4-diphenylpyrrolidine.
| Compound Name | (3R,4R)-2,2-dimethyl-3,4-diphenylpyrrolidine |
|---|---|
| PubChem CID | 131847538 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (3R,4R)-2,2-dimethyl-3,4-diphenylpyrrolidine |
| SMILES | CC1(C)NC[C@@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H21N/c1-18(2)17(15-11-7-4-8-12-15)16(13-19-18)14-9-5-3-6-10-14/h3-12,16-17,19H,13H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | PAQZXYYTPJFOEM-IRXDYDNUSA-N |
| XLogP | 3.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |