C32H32 — CID 124794227
[(1S,2S,3R,4R)-5,5-dimethyl-2,3,4-triphenylcyclohexyl]benzene (PubChem CID 124794227) has the molecular formula C32H32 and a molecular weight of 416.61 g/mol. Its IUPAC name is [(1S,2S,3R,4R)-5,5-dimethyl-2,3,4-triphenylcyclohexyl]benzene.
| Compound Name | [(1S,2S,3R,4R)-5,5-dimethyl-2,3,4-triphenylcyclohexyl]benzene |
|---|---|
| PubChem CID | 124794227 |
| Molecular Formula | C32H32 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | [(1S,2S,3R,4R)-5,5-dimethyl-2,3,4-triphenylcyclohexyl]benzene |
| SMILES | CC1(C)C[C@H](c2ccccc2)[C@H](c2ccccc2)[C@@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C32H32/c1-32(2)23-28(24-15-7-3-8-16-24)29(25-17-9-4-10-18-25)30(26-19-11-5-12-20-26)31(32)27-21-13-6-14-22-27/h3-22,28-31H,23H2,1-2H3/t28-,29+,30-,31-/m1/s1 |
| InChIKey | KZSPFWUYMYGYBL-YXOGWZJSSA-N |
| XLogP | 8.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |