C11H13NOS — CID 130010020
5,5-dimethyl-2-phenyl-1,3-thiazolidin-4-one (PubChem CID 130010020) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is 5,5-dimethyl-2-phenyl-1,3-thiazolidin-4-one.
| Compound Name | 5,5-dimethyl-2-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 130010020 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 5,5-dimethyl-2-phenyl-1,3-thiazolidin-4-one |
| SMILES | CC1(C)SC(c2ccccc2)NC1=O |
| InChI | InChI=1S/C11H13NOS/c1-11(2)10(13)12-9(14-11)8-6-4-3-5-7-8/h3-7,9H,1-2H3,(H,12,13) |
| InChIKey | GBSYGXKPBHKQEU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |