C29H25NO3 — CID 135030842
1-benzoyl-8,11-dimethyl-14-phenyl-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12-dione (PubChem CID 135030842) has the molecular formula C29H25NO3 and a molecular weight of 435.52 g/mol. Its IUPAC name is 1-benzoyl-8,11-dimethyl-14-phenyl-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12-dione.
| Compound Name | 1-benzoyl-8,11-dimethyl-14-phenyl-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12-dione |
|---|---|
| PubChem CID | 135030842 |
| Molecular Formula | C29H25NO3 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 1-benzoyl-8,11-dimethyl-14-phenyl-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12-dione |
| SMILES | CN1C(=O)C2C(C1=O)C1(C(=O)c3ccccc3)c3ccccc3C2(C)CC1c1ccccc1 |
| InChI | InChI=1S/C29H25NO3/c1-28-17-22(18-11-5-3-6-12-18)29(21-16-10-9-15-20(21)28,25(31)19-13-7-4-8-14-19)24-23(28)26(32)30(2)27(24)33/h3-16,22-24H,17H2,1-2H3 |
| InChIKey | ZNTIMTDEIAMOCI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|