C23H24O7S — CID 132539453
trimethyl (2S,3R,4S)-4-phenacyl-2-thiophen-2-ylcyclopentane-1,1,3-tricarboxylate (PubChem CID 132539453) has the molecular formula C23H24O7S and a molecular weight of 444.51 g/mol. Its IUPAC name is trimethyl (2S,3R,4S)-4-phenacyl-2-thiophen-2-ylcyclopentane-1,1,3-tricarboxylate.
| Compound Name | trimethyl (2S,3R,4S)-4-phenacyl-2-thiophen-2-ylcyclopentane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 132539453 |
| Molecular Formula | C23H24O7S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | trimethyl (2S,3R,4S)-4-phenacyl-2-thiophen-2-ylcyclopentane-1,1,3-tricarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](CC(=O)c2ccccc2)CC(C(=O)OC)(C(=O)OC)[C@H]1c1cccs1 |
| InChI | InChI=1S/C23H24O7S/c1-28-20(25)18-15(12-16(24)14-8-5-4-6-9-14)13-23(21(26)29-2,22(27)30-3)19(18)17-10-7-11-31-17/h4-11,15,18-19H,12-13H2,1-3H3/t15-,18-,19+/m1/s1 |
| InChIKey | BYSGJJCLSJMDBI-LZQZEXGQSA-N |
| XLogP | 3.25 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|