C19H18O3 — CID 102418918
methyl (1R,2R)-1-phenacyl-2,3-dihydro-1H-indene-2-carboxylate (PubChem CID 102418918) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is methyl (1R,2R)-1-phenacyl-2,3-dihydro-1H-indene-2-carboxylate.
| Compound Name | methyl (1R,2R)-1-phenacyl-2,3-dihydro-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 102418918 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | methyl (1R,2R)-1-phenacyl-2,3-dihydro-1H-indene-2-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2ccccc2[C@@H]1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18O3/c1-22-19(21)17-11-14-9-5-6-10-15(14)16(17)12-18(20)13-7-3-2-4-8-13/h2-10,16-17H,11-12H2,1H3/t16-,17+/m0/s1 |
| InChIKey | NTEKUZWMFHEZOJ-DLBZAZTESA-N |
| XLogP | 3.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |