C20H16O4 — CID 11045424
methyl 2-oxo-2-[(1S,2S)-1-(2-oxo-1-phenylethenyl)-2,3-dihydro-1H-inden-2-yl]acetate (PubChem CID 11045424) has the molecular formula C20H16O4 and a molecular weight of 320.34 g/mol. Its IUPAC name is methyl 2-oxo-2-[(1S,2S)-1-(2-oxo-1-phenylethenyl)-2,3-dihydro-1H-inden-2-yl]acetate.
| Compound Name | methyl 2-oxo-2-[(1S,2S)-1-(2-oxo-1-phenylethenyl)-2,3-dihydro-1H-inden-2-yl]acetate |
|---|---|
| PubChem CID | 11045424 |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | methyl 2-oxo-2-[(1S,2S)-1-(2-oxo-1-phenylethenyl)-2,3-dihydro-1H-inden-2-yl]acetate |
| SMILES | COC(=O)C(=O)[C@H]1Cc2ccccc2[C@H]1C(=C=O)c1ccccc1 |
| InChI | InChI=1S/C20H16O4/c1-24-20(23)19(22)16-11-14-9-5-6-10-15(14)18(16)17(12-21)13-7-3-2-4-8-13/h2-10,16,18H,11H2,1H3/t16-,18+/m0/s1 |
| InChIKey | DTVSAWHJJURJCQ-FUHWJXTLSA-N |
| XLogP | 2.60 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|