C29H24O8 — CID 14744222
methyl 2-[6-(2-methoxy-2-oxoacetyl)-3,5-bis(2-oxo-1-phenylethenyl)-2-bicyclo[2.2.1]heptanyl]-2-oxoacetate (PubChem CID 14744222) has the molecular formula C29H24O8 and a molecular weight of 500.50 g/mol. Its IUPAC name is methyl 2-[6-(2-methoxy-2-oxoacetyl)-3,5-bis(2-oxo-1-phenylethenyl)-2-bicyclo[2.2.1]heptanyl]-2-oxoacetate.
| Compound Name | methyl 2-[6-(2-methoxy-2-oxoacetyl)-3,5-bis(2-oxo-1-phenylethenyl)-2-bicyclo[2.2.1]heptanyl]-2-oxoacetate |
|---|---|
| PubChem CID | 14744222 |
| Molecular Formula | C29H24O8 |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | methyl 2-[6-(2-methoxy-2-oxoacetyl)-3,5-bis(2-oxo-1-phenylethenyl)-2-bicyclo[2.2.1]heptanyl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)C1C2CC(C1C(=C=O)c1ccccc1)C(C(=C=O)c1ccccc1)C2C(=O)C(=O)OC |
| InChI | InChI=1S/C29H24O8/c1-36-28(34)26(32)24-19-13-18(22(24)20(14-30)16-9-5-3-6-10-16)23(25(19)27(33)29(35)37-2)21(15-31)17-11-7-4-8-12-17/h3-12,18-19,22-25H,13H2,1-2H3 |
| InChIKey | TWFCNWXGYPQPEW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|