C22H25NO6S — CID 122234388
4-O,4-O'-diethyl 2-O-methyl (2R,3R,5S)-3-phenyl-5-thiophen-2-ylpyrrolidine-2,4,4-tricarboxylate (PubChem CID 122234388) has the molecular formula C22H25NO6S and a molecular weight of 431.51 g/mol. Its IUPAC name is 4-O,4-O'-diethyl 2-O-methyl (2R,3R,5S)-3-phenyl-5-thiophen-2-ylpyrrolidine-2,4,4-tricarboxylate.
| Compound Name | 4-O,4-O'-diethyl 2-O-methyl (2R,3R,5S)-3-phenyl-5-thiophen-2-ylpyrrolidine-2,4,4-tricarboxylate |
|---|---|
| PubChem CID | 122234388 |
| Molecular Formula | C22H25NO6S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 4-O,4-O'-diethyl 2-O-methyl (2R,3R,5S)-3-phenyl-5-thiophen-2-ylpyrrolidine-2,4,4-tricarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@@H](c2cccs2)N[C@@H](C(=O)OC)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H25NO6S/c1-4-28-20(25)22(21(26)29-5-2)16(14-10-7-6-8-11-14)17(19(24)27-3)23-18(22)15-12-9-13-30-15/h6-13,16-18,23H,4-5H2,1-3H3/t16-,17+,18+/m0/s1 |
| InChIKey | ATMATPFKENNSNH-RCCFBDPRSA-N |
| XLogP | 2.83 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|