C16H15NO3S2 — CID 10314786
ethyl (2R,3S)-4-oxo-2-thiophen-2-yl-3,5-dihydro-2H-1,5-benzothiazepine-3-carboxylate (PubChem CID 10314786) has the molecular formula C16H15NO3S2 and a molecular weight of 333.43 g/mol. Its IUPAC name is ethyl (2R,3S)-4-oxo-2-thiophen-2-yl-3,5-dihydro-2H-1,5-benzothiazepine-3-carboxylate.
| Compound Name | ethyl (2R,3S)-4-oxo-2-thiophen-2-yl-3,5-dihydro-2H-1,5-benzothiazepine-3-carboxylate |
|---|---|
| PubChem CID | 10314786 |
| Molecular Formula | C16H15NO3S2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | ethyl (2R,3S)-4-oxo-2-thiophen-2-yl-3,5-dihydro-2H-1,5-benzothiazepine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)Nc2ccccc2S[C@H]1c1cccs1 |
| InChI | InChI=1S/C16H15NO3S2/c1-2-20-16(19)13-14(12-8-5-9-21-12)22-11-7-4-3-6-10(11)17-15(13)18/h3-9,13-14H,2H2,1H3,(H,17,18)/t13-,14-/m0/s1 |
| InChIKey | JNNFUGNCPVNLCP-KBPBESRZSA-N |
| XLogP | 3.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|