C20H18N2O3S2 — CID 7768481
ethyl (3R,4R)-6-benzylsulfanyl-5-cyano-2-oxo-4-thiophen-2-yl-3,4-dihydro-1H-pyridine-3-carboxylate (PubChem CID 7768481) has the molecular formula C20H18N2O3S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is ethyl (3R,4R)-6-benzylsulfanyl-5-cyano-2-oxo-4-thiophen-2-yl-3,4-dihydro-1H-pyridine-3-carboxylate.
| Compound Name | ethyl (3R,4R)-6-benzylsulfanyl-5-cyano-2-oxo-4-thiophen-2-yl-3,4-dihydro-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 7768481 |
| Molecular Formula | C20H18N2O3S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | ethyl (3R,4R)-6-benzylsulfanyl-5-cyano-2-oxo-4-thiophen-2-yl-3,4-dihydro-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)NC(SCc2ccccc2)=C(C#N)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C20H18N2O3S2/c1-2-25-20(24)17-16(15-9-6-10-26-15)14(11-21)19(22-18(17)23)27-12-13-7-4-3-5-8-13/h3-10,16-17H,2,12H2,1H3,(H,22,23)/t16-,17-/m1/s1 |
| InChIKey | AYAZLOGXFQNMLG-IAGOWNOFSA-N |
| XLogP | 3.81 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|