C32H31NO6 — CID 53387142
4-O,4-O'-diethyl 2-O-methyl (2R,5R)-3-(2,2-diphenylethenylidene)-5-phenylpyrrolidine-2,4,4-tricarboxylate (PubChem CID 53387142) has the molecular formula C32H31NO6 and a molecular weight of 525.60 g/mol. Its IUPAC name is 4-O,4-O'-diethyl 2-O-methyl (2R,5R)-3-(2,2-diphenylethenylidene)-5-phenylpyrrolidine-2,4,4-tricarboxylate.
| Compound Name | 4-O,4-O'-diethyl 2-O-methyl (2R,5R)-3-(2,2-diphenylethenylidene)-5-phenylpyrrolidine-2,4,4-tricarboxylate |
|---|---|
| PubChem CID | 53387142 |
| Molecular Formula | C32H31NO6 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | 4-O,4-O'-diethyl 2-O-methyl (2R,5R)-3-(2,2-diphenylethenylidene)-5-phenylpyrrolidine-2,4,4-tricarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C(=C=C(c2ccccc2)c2ccccc2)[C@H](C(=O)OC)N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C32H31NO6/c1-4-38-30(35)32(31(36)39-5-2)26(27(29(34)37-3)33-28(32)24-19-13-8-14-20-24)21-25(22-15-9-6-10-16-22)23-17-11-7-12-18-23/h6-20,27-28,33H,4-5H2,1-3H3/t27-,28-/m1/s1 |
| InChIKey | XKOZYNNSHJWAOX-VSGBNLITSA-N |
| XLogP | 4.64 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|