C33H32BrNO6 — CID 53387469
4-O,4-O'-diethyl 2-O-methyl (2R,5R)-5-(4-bromophenyl)-3-(2,2-diphenylethenylidene)-2-methylpyrrolidine-2,4,4-tricarboxylate (PubChem CID 53387469) has the molecular formula C33H32BrNO6 and a molecular weight of 618.52 g/mol. Its IUPAC name is 4-O,4-O'-diethyl 2-O-methyl (2R,5R)-5-(4-bromophenyl)-3-(2,2-diphenylethenylidene)-2-methylpyrrolidine-2,4,4-tricarboxylate.
| Compound Name | 4-O,4-O'-diethyl 2-O-methyl (2R,5R)-5-(4-bromophenyl)-3-(2,2-diphenylethenylidene)-2-methylpyrrolidine-2,4,4-tricarboxylate |
|---|---|
| PubChem CID | 53387469 |
| Molecular Formula | C33H32BrNO6 |
| Molecular Weight | 618.52 g/mol |
| Exact Mass | 617.14 |
| IUPAC Name | 4-O,4-O'-diethyl 2-O-methyl (2R,5R)-5-(4-bromophenyl)-3-(2,2-diphenylethenylidene)-2-methylpyrrolidine-2,4,4-tricarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C(=C=C(c2ccccc2)c2ccccc2)[C@](C)(C(=O)OC)N[C@@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C33H32BrNO6/c1-5-40-30(37)33(31(38)41-6-2)27(21-26(22-13-9-7-10-14-22)23-15-11-8-12-16-23)32(3,29(36)39-4)35-28(33)24-17-19-25(34)20-18-24/h7-20,28,35H,5-6H2,1-4H3/t28-,32-/m1/s1 |
| InChIKey | OTBDKGWYZMAIPQ-AKGWNBJDSA-N |
| XLogP | 5.79 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|