C30H25BrO3 — CID 141454766
ethyl 2-[4-[2-(4-bromophenyl)-1,2-diphenylethenyl]phenoxy]acetate (PubChem CID 141454766) has the molecular formula C30H25BrO3 and a molecular weight of 513.43 g/mol. Its IUPAC name is ethyl 2-[4-[2-(4-bromophenyl)-1,2-diphenylethenyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[2-(4-bromophenyl)-1,2-diphenylethenyl]phenoxy]acetate |
|---|---|
| PubChem CID | 141454766 |
| Molecular Formula | C30H25BrO3 |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | ethyl 2-[4-[2-(4-bromophenyl)-1,2-diphenylethenyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C(=C(c2ccccc2)c2ccc(Br)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H25BrO3/c1-2-33-28(32)21-34-27-19-15-25(16-20-27)30(23-11-7-4-8-12-23)29(22-9-5-3-6-10-22)24-13-17-26(31)18-14-24/h3-20H,2,21H2,1H3 |
| InChIKey | XUCNNZYGRJQSHZ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|