C14H17NO4 — CID 142006795
ethyl 2-[4-[(E)-4-amino-4-oxobut-2-en-2-yl]phenoxy]acetate (PubChem CID 142006795) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-4-amino-4-oxobut-2-en-2-yl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[(E)-4-amino-4-oxobut-2-en-2-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 142006795 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | ethyl 2-[4-[(E)-4-amino-4-oxobut-2-en-2-yl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(/C(C)=C/C(N)=O)cc1 |
| InChI | InChI=1S/C14H17NO4/c1-3-18-14(17)9-19-12-6-4-11(5-7-12)10(2)8-13(15)16/h4-8H,3,9H2,1-2H3,(H2,15,16)/b10-8+ |
| InChIKey | JEEDXQHBKNAGBF-CSKARUKUSA-N |
| XLogP | 1.52 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|