C46H44Br2F6N4O10 — CID 139125939
ethyl (2S,3R,4R,5S)-5-(4-bromophenyl)-2,4-dimethyl-3-(4-nitrobenzoyl)-4-(trifluoromethyl)pyrrolidine-2-carboxylate (PubChem CID 139125939) has the molecular formula C46H44Br2F6N4O10 and a molecular weight of 1086.67 g/mol. Its IUPAC name is ethyl (2S,3R,4R,5S)-5-(4-bromophenyl)-2,4-dimethyl-3-(4-nitrobenzoyl)-4-(trifluoromethyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,3R,4R,5S)-5-(4-bromophenyl)-2,4-dimethyl-3-(4-nitrobenzoyl)-4-(trifluoromethyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 139125939 |
| Molecular Formula | C46H44Br2F6N4O10 |
| Molecular Weight | 1086.67 g/mol |
| Exact Mass | 1084.13 |
| IUPAC Name | ethyl (2S,3R,4R,5S)-5-(4-bromophenyl)-2,4-dimethyl-3-(4-nitrobenzoyl)-4-(trifluoromethyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)N[C@@H](c2ccc(Br)cc2)[C@](C)(C(F)(F)F)[C@H]1C(=O)c1ccc([N+](=O)[O-])cc1.CCOC(=O)[C@@]1(C)N[C@@H](c2ccc(Br)cc2)[C@](C)(C(F)(F)F)[C@H]1C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/2C23H22BrF3N2O5/c2*1-4-34-20(31)22(3)18(17(30)13-7-11-16(12-8-13)29(32)33)21(2,23(25,26)27)19(28-22)14-5-9-15(24)10-6-14/h2*5-12,18-19,28H,4H2,1-3H3/t2*18-,19+,21-,22+/m11/s1 |
| InChIKey | GIZZEWBQQYJXCJ-JGCFLLJUSA-N |
| XLogP | 10.78 |
| TPSA | 197.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1086.67 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|