C31H30N4O7 — CID 132584979
diethyl (5R,6R,9S)-1-methyl-6-(4-nitrophenyl)-4-oxo-3,9-diphenyl-2,3,7-triazaspiro[4.4]non-1-ene-8,8-dicarboxylate (PubChem CID 132584979) has the molecular formula C31H30N4O7 and a molecular weight of 570.60 g/mol. Its IUPAC name is diethyl (5R,6R,9S)-1-methyl-6-(4-nitrophenyl)-4-oxo-3,9-diphenyl-2,3,7-triazaspiro[4.4]non-1-ene-8,8-dicarboxylate.
| Compound Name | diethyl (5R,6R,9S)-1-methyl-6-(4-nitrophenyl)-4-oxo-3,9-diphenyl-2,3,7-triazaspiro[4.4]non-1-ene-8,8-dicarboxylate |
|---|---|
| PubChem CID | 132584979 |
| Molecular Formula | C31H30N4O7 |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | diethyl (5R,6R,9S)-1-methyl-6-(4-nitrophenyl)-4-oxo-3,9-diphenyl-2,3,7-triazaspiro[4.4]non-1-ene-8,8-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)N[C@H](c2ccc([N+](=O)[O-])cc2)[C@]2(C(=O)N(c3ccccc3)N=C2C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C31H30N4O7/c1-4-41-28(37)31(29(38)42-5-2)25(21-12-8-6-9-13-21)30(26(32-31)22-16-18-24(19-17-22)35(39)40)20(3)33-34(27(30)36)23-14-10-7-11-15-23/h6-19,25-26,32H,4-5H2,1-3H3/t25-,26+,30+/m0/s1 |
| InChIKey | DKBXFAFJIATQSE-LUXHBGHRSA-N |
| XLogP | 4.30 |
| TPSA | 140.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|