C16H17N3O3 — CID 70677471
ethyl 2-[4-(cyanomethyl)-3-methyl-5-oxo-1-phenylpyrazol-4-yl]acetate (PubChem CID 70677471) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is ethyl 2-[4-(cyanomethyl)-3-methyl-5-oxo-1-phenylpyrazol-4-yl]acetate.
| Compound Name | ethyl 2-[4-(cyanomethyl)-3-methyl-5-oxo-1-phenylpyrazol-4-yl]acetate |
|---|---|
| PubChem CID | 70677471 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | ethyl 2-[4-(cyanomethyl)-3-methyl-5-oxo-1-phenylpyrazol-4-yl]acetate |
| SMILES | CCOC(=O)CC1(CC#N)C(=O)N(c2ccccc2)N=C1C |
| InChI | InChI=1S/C16H17N3O3/c1-3-22-14(20)11-16(9-10-17)12(2)18-19(15(16)21)13-7-5-4-6-8-13/h4-8H,3,9,11H2,1-2H3 |
| InChIKey | BSHAVIVBCIUSLX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 82.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |