C22H21N3O3S — CID 71507753
ethyl (5S,8S,9R)-1-methyl-4-oxo-3,9-diphenyl-6-sulfanylidene-2,3,7-triazaspiro[4.4]non-1-ene-8-carboxylate (PubChem CID 71507753) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is ethyl (5S,8S,9R)-1-methyl-4-oxo-3,9-diphenyl-6-sulfanylidene-2,3,7-triazaspiro[4.4]non-1-ene-8-carboxylate.
| Compound Name | ethyl (5S,8S,9R)-1-methyl-4-oxo-3,9-diphenyl-6-sulfanylidene-2,3,7-triazaspiro[4.4]non-1-ene-8-carboxylate |
|---|---|
| PubChem CID | 71507753 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | ethyl (5S,8S,9R)-1-methyl-4-oxo-3,9-diphenyl-6-sulfanylidene-2,3,7-triazaspiro[4.4]non-1-ene-8-carboxylate |
| SMILES | CCOC(=O)[C@H]1NC(=S)[C@@]2(C(=O)N(c3ccccc3)N=C2C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H21N3O3S/c1-3-28-19(26)18-17(15-10-6-4-7-11-15)22(20(29)23-18)14(2)24-25(21(22)27)16-12-8-5-9-13-16/h4-13,17-18H,3H2,1-2H3,(H,23,29)/t17-,18-,22-/m0/s1 |
| InChIKey | NSASPGDTKZEYLL-SPEDKVCISA-N |
| XLogP | 3.04 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|