C17H14BrFO2 — CID 118237237
methyl 2-(4-bromophenyl)-1-fluoro-3-phenylcyclopropane-1-carboxylate (PubChem CID 118237237) has the molecular formula C17H14BrFO2 and a molecular weight of 349.20 g/mol. Its IUPAC name is methyl 2-(4-bromophenyl)-1-fluoro-3-phenylcyclopropane-1-carboxylate.
| Compound Name | methyl 2-(4-bromophenyl)-1-fluoro-3-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 118237237 |
| Molecular Formula | C17H14BrFO2 |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | methyl 2-(4-bromophenyl)-1-fluoro-3-phenylcyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(F)C(c2ccccc2)C1c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H14BrFO2/c1-21-16(20)17(19)14(11-5-3-2-4-6-11)15(17)12-7-9-13(18)10-8-12/h2-10,14-15H,1H3 |
| InChIKey | CQFYNXGDBMPAJA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |