C33H30Br2N2O6 — CID 56656594
dimethyl (1R,3R,3aR,4aR,5S,7R,7aS,8aS)-1,5-bis(4-bromophenyl)-7-methyl-4,8-dioxo-3-phenyl-1,2,3a,4a,5,6,7a,8a-octahydropyrrolo[3,4-f]isoindole-3,7-dicarboxylate (PubChem CID 56656594) has the molecular formula C33H30Br2N2O6 and a molecular weight of 710.42 g/mol. Its IUPAC name is dimethyl (1R,3R,3aR,4aR,5S,7R,7aS,8aS)-1,5-bis(4-bromophenyl)-7-methyl-4,8-dioxo-3-phenyl-1,2,3a,4a,5,6,7a,8a-octahydropyrrolo[3,4-f]isoindole-3,7-dicarboxylate.
| Compound Name | dimethyl (1R,3R,3aR,4aR,5S,7R,7aS,8aS)-1,5-bis(4-bromophenyl)-7-methyl-4,8-dioxo-3-phenyl-1,2,3a,4a,5,6,7a,8a-octahydropyrrolo[3,4-f]isoindole-3,7-dicarboxylate |
|---|---|
| PubChem CID | 56656594 |
| Molecular Formula | C33H30Br2N2O6 |
| Molecular Weight | 710.42 g/mol |
| Exact Mass | 708.05 |
| IUPAC Name | dimethyl (1R,3R,3aR,4aR,5S,7R,7aS,8aS)-1,5-bis(4-bromophenyl)-7-methyl-4,8-dioxo-3-phenyl-1,2,3a,4a,5,6,7a,8a-octahydropyrrolo[3,4-f]isoindole-3,7-dicarboxylate |
| SMILES | COC(=O)[C@]1(C)N[C@H](c2ccc(Br)cc2)[C@@H]2C(=O)[C@@H]3[C@H](C(=O)[C@@H]21)[C@H](c1ccc(Br)cc1)N[C@@]3(C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C33H30Br2N2O6/c1-32(30(40)42-2)24-22(26(36-32)17-9-13-20(34)14-10-17)29(39)25-23(28(24)38)27(18-11-15-21(35)16-12-18)37-33(25,31(41)43-3)19-7-5-4-6-8-19/h4-16,22-27,36-37H,1-3H3/t22-,23+,24-,25+,26-,27+,32-,33+/m1/s1 |
| InChIKey | UAVOUGGEXRIJEC-JRNZLTAMSA-N |
| XLogP | 4.82 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |