C16H17ClN2O4 — CID 3217337
methyl 1-(4-chlorophenyl)-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 3217337) has the molecular formula C16H17ClN2O4 and a molecular weight of 336.78 g/mol. Its IUPAC name is methyl 1-(4-chlorophenyl)-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl 1-(4-chlorophenyl)-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 3217337 |
| Molecular Formula | C16H17ClN2O4 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | methyl 1-(4-chlorophenyl)-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | COC(=O)C1(C)NC(c2ccc(Cl)cc2)C2C(=O)N(C)C(=O)C21 |
| InChI | InChI=1S/C16H17ClN2O4/c1-16(15(22)23-3)11-10(13(20)19(2)14(11)21)12(18-16)8-4-6-9(17)7-5-8/h4-7,10-12,18H,1-3H3 |
| InChIKey | QBGQCINBSKQEPH-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|