C36H34N2O6 — CID 56656572
dimethyl (1R,3S,3aR,4aR,5S,7R,7aS,8aS)-3,7-dimethyl-1,5-dinaphthalen-2-yl-4,8-dioxo-1,2,3a,4a,5,6,7a,8a-octahydropyrrolo[3,4-f]isoindole-3,7-dicarboxylate (PubChem CID 56656572) has the molecular formula C36H34N2O6 and a molecular weight of 590.68 g/mol. Its IUPAC name is dimethyl (1R,3S,3aR,4aR,5S,7R,7aS,8aS)-3,7-dimethyl-1,5-dinaphthalen-2-yl-4,8-dioxo-1,2,3a,4a,5,6,7a,8a-octahydropyrrolo[3,4-f]isoindole-3,7-dicarboxylate.
| Compound Name | dimethyl (1R,3S,3aR,4aR,5S,7R,7aS,8aS)-3,7-dimethyl-1,5-dinaphthalen-2-yl-4,8-dioxo-1,2,3a,4a,5,6,7a,8a-octahydropyrrolo[3,4-f]isoindole-3,7-dicarboxylate |
|---|---|
| PubChem CID | 56656572 |
| Molecular Formula | C36H34N2O6 |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | dimethyl (1R,3S,3aR,4aR,5S,7R,7aS,8aS)-3,7-dimethyl-1,5-dinaphthalen-2-yl-4,8-dioxo-1,2,3a,4a,5,6,7a,8a-octahydropyrrolo[3,4-f]isoindole-3,7-dicarboxylate |
| SMILES | COC(=O)[C@]1(C)N[C@H](c2ccc3ccccc3c2)[C@@H]2C(=O)[C@@H]3[C@H](C(=O)[C@@H]21)[C@H](c1ccc2ccccc2c1)N[C@]3(C)C(=O)OC |
| InChI | InChI=1S/C36H34N2O6/c1-35(33(41)43-3)27-25(29(37-35)23-15-13-19-9-5-7-11-21(19)17-23)32(40)28-26(31(27)39)30(38-36(28,2)34(42)44-4)24-16-14-20-10-6-8-12-22(20)18-24/h5-18,25-30,37-38H,1-4H3/t25-,26+,27-,28+,29-,30+,35-,36+ |
| InChIKey | MMCJMSBLCHLXKC-FPLZWHCJSA-N |
| XLogP | 4.46 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |