C21H19NO4 — CID 56656579
methyl (1S,3S)-4,7-dihydroxy-1-methyl-3-naphthalen-2-yl-2,3-dihydroisoindole-1-carboxylate (PubChem CID 56656579) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is methyl (1S,3S)-4,7-dihydroxy-1-methyl-3-naphthalen-2-yl-2,3-dihydroisoindole-1-carboxylate.
| Compound Name | methyl (1S,3S)-4,7-dihydroxy-1-methyl-3-naphthalen-2-yl-2,3-dihydroisoindole-1-carboxylate |
|---|---|
| PubChem CID | 56656579 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | methyl (1S,3S)-4,7-dihydroxy-1-methyl-3-naphthalen-2-yl-2,3-dihydroisoindole-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)N[C@@H](c2ccc3ccccc3c2)c2c(O)ccc(O)c21 |
| InChI | InChI=1S/C21H19NO4/c1-21(20(25)26-2)18-16(24)10-9-15(23)17(18)19(22-21)14-8-7-12-5-3-4-6-13(12)11-14/h3-11,19,22-24H,1-2H3/t19-,21-/m0/s1 |
| InChIKey | GBGNRNCJPSUMHN-FPOVZHCZSA-N |
| XLogP | 3.33 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|