C22H20O5 — CID 11222265
dimethyl (2S,5R)-5-phenyl-2-(2-phenylethynyl)oxolane-3,3-dicarboxylate (PubChem CID 11222265) has the molecular formula C22H20O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is dimethyl (2S,5R)-5-phenyl-2-(2-phenylethynyl)oxolane-3,3-dicarboxylate.
| Compound Name | dimethyl (2S,5R)-5-phenyl-2-(2-phenylethynyl)oxolane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 11222265 |
| Molecular Formula | C22H20O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | dimethyl (2S,5R)-5-phenyl-2-(2-phenylethynyl)oxolane-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](c2ccccc2)O[C@H]1C#Cc1ccccc1 |
| InChI | InChI=1S/C22H20O5/c1-25-20(23)22(21(24)26-2)15-18(17-11-7-4-8-12-17)27-19(22)14-13-16-9-5-3-6-10-16/h3-12,18-19H,15H2,1-2H3/t18-,19+/m1/s1 |
| InChIKey | SXGOJYLFFAGHTC-MOPGFXCFSA-N |
| XLogP | 2.90 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|