C21H18O4 — CID 135028383
dimethyl 2-[2-(2-phenylethynyl)phenyl]cyclopropane-1,1-dicarboxylate (PubChem CID 135028383) has the molecular formula C21H18O4 and a molecular weight of 334.37 g/mol. Its IUPAC name is dimethyl 2-[2-(2-phenylethynyl)phenyl]cyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl 2-[2-(2-phenylethynyl)phenyl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 135028383 |
| Molecular Formula | C21H18O4 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | dimethyl 2-[2-(2-phenylethynyl)phenyl]cyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC1c1ccccc1C#Cc1ccccc1 |
| InChI | InChI=1S/C21H18O4/c1-24-19(22)21(20(23)25-2)14-18(21)17-11-7-6-10-16(17)13-12-15-8-4-3-5-9-15/h3-11,18H,14H2,1-2H3 |
| InChIKey | HOJPEVGDPUGUGB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|