C24H19NO4 — CID 135028571
dimethyl 2-[2-(2-quinolin-3-ylethynyl)phenyl]cyclopropane-1,1-dicarboxylate (PubChem CID 135028571) has the molecular formula C24H19NO4 and a molecular weight of 385.42 g/mol. Its IUPAC name is dimethyl 2-[2-(2-quinolin-3-ylethynyl)phenyl]cyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl 2-[2-(2-quinolin-3-ylethynyl)phenyl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 135028571 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | dimethyl 2-[2-(2-quinolin-3-ylethynyl)phenyl]cyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC1c1ccccc1C#Cc1cnc2ccccc2c1 |
| InChI | InChI=1S/C24H19NO4/c1-28-22(26)24(23(27)29-2)14-20(24)19-9-5-3-7-17(19)12-11-16-13-18-8-4-6-10-21(18)25-15-16/h3-10,13,15,20H,14H2,1-2H3 |
| InChIKey | PJNWZVNOOGUJSC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|