C33H37NO4 — CID 177411510
dimethyl 1-benzyl-7,10,10-trimethyl-2-phenyl-4,4a,5,10a-tetrahydro-2H-benzo[g]quinoline-3,3-dicarboxylate (PubChem CID 177411510) has the molecular formula C33H37NO4 and a molecular weight of 511.66 g/mol. Its IUPAC name is dimethyl 1-benzyl-7,10,10-trimethyl-2-phenyl-4,4a,5,10a-tetrahydro-2H-benzo[g]quinoline-3,3-dicarboxylate.
| Compound Name | dimethyl 1-benzyl-7,10,10-trimethyl-2-phenyl-4,4a,5,10a-tetrahydro-2H-benzo[g]quinoline-3,3-dicarboxylate |
|---|---|
| PubChem CID | 177411510 |
| Molecular Formula | C33H37NO4 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | dimethyl 1-benzyl-7,10,10-trimethyl-2-phenyl-4,4a,5,10a-tetrahydro-2H-benzo[g]quinoline-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2Cc3cc(C)ccc3C(C)(C)C2N(Cc2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C33H37NO4/c1-22-16-17-27-25(18-22)19-26-20-33(30(35)37-4,31(36)38-5)29(24-14-10-7-11-15-24)34(28(26)32(27,2)3)21-23-12-8-6-9-13-23/h6-18,26,28-29H,19-21H2,1-5H3 |
| InChIKey | ZYVVKNQJRHKANI-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|