C17H23NO — CID 10825058
(1R,5R,6S)-8-benzyl-6-propyl-8-azabicyclo[3.2.1]octan-2-one (PubChem CID 10825058) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is (1R,5R,6S)-8-benzyl-6-propyl-8-azabicyclo[3.2.1]octan-2-one.
| Compound Name | (1R,5R,6S)-8-benzyl-6-propyl-8-azabicyclo[3.2.1]octan-2-one |
|---|---|
| PubChem CID | 10825058 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (1R,5R,6S)-8-benzyl-6-propyl-8-azabicyclo[3.2.1]octan-2-one |
| SMILES | CCC[C@H]1C[C@@H]2C(=O)CC[C@H]1N2Cc1ccccc1 |
| InChI | InChI=1S/C17H23NO/c1-2-6-14-11-16-17(19)10-9-15(14)18(16)12-13-7-4-3-5-8-13/h3-5,7-8,14-16H,2,6,9-12H2,1H3/t14-,15+,16+/m0/s1 |
| InChIKey | QKNLHUPEDPEXOF-ARFHVFGLSA-N |
| XLogP | 3.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |