C17H23N — CID 134905454
(1R,4S)-7-benzyl-2-but-3-enyl-7-azabicyclo[2.2.1]heptane (PubChem CID 134905454) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is (1R,4S)-7-benzyl-2-but-3-enyl-7-azabicyclo[2.2.1]heptane.
| Compound Name | (1R,4S)-7-benzyl-2-but-3-enyl-7-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 134905454 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | (1R,4S)-7-benzyl-2-but-3-enyl-7-azabicyclo[2.2.1]heptane |
| SMILES | C=CCCC1C[C@@H]2CC[C@H]1N2Cc1ccccc1 |
| InChI | InChI=1S/C17H23N/c1-2-3-9-15-12-16-10-11-17(15)18(16)13-14-7-5-4-6-8-14/h2,4-8,15-17H,1,3,9-13H2/t15?,16-,17+/m0/s1 |
| InChIKey | WICSCQVOXSSZPJ-LRUHZDSUSA-N |
| XLogP | 4.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|