C19H24N2 — CID 125496066
(1S,2S,3R,6S)-9-benzyl-3-prop-2-enyl-9-azabicyclo[4.2.1]nonane-2-carbonitrile (PubChem CID 125496066) has the molecular formula C19H24N2 and a molecular weight of 280.41 g/mol. Its IUPAC name is (1S,2S,3R,6S)-9-benzyl-3-prop-2-enyl-9-azabicyclo[4.2.1]nonane-2-carbonitrile.
| Compound Name | (1S,2S,3R,6S)-9-benzyl-3-prop-2-enyl-9-azabicyclo[4.2.1]nonane-2-carbonitrile |
|---|---|
| PubChem CID | 125496066 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (1S,2S,3R,6S)-9-benzyl-3-prop-2-enyl-9-azabicyclo[4.2.1]nonane-2-carbonitrile |
| SMILES | C=CC[C@H]1CC[C@H]2CC[C@@H]([C@H]1C#N)N2Cc1ccccc1 |
| InChI | InChI=1S/C19H24N2/c1-2-6-16-9-10-17-11-12-19(18(16)13-20)21(17)14-15-7-4-3-5-8-15/h2-5,7-8,16-19H,1,6,9-12,14H2/t16-,17-,18-,19-/m0/s1 |
| InChIKey | QZOQKIYZTNVSJN-VJANTYMQSA-N |
| XLogP | 4.15 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|