C24H32O4 — CID 158152316
butanal;2-phenyloxirane;4-phenyl-2-propyl-1,3-dioxolane (PubChem CID 158152316) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is butanal;2-phenyloxirane;4-phenyl-2-propyl-1,3-dioxolane.
| Compound Name | butanal;2-phenyloxirane;4-phenyl-2-propyl-1,3-dioxolane |
|---|---|
| PubChem CID | 158152316 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | butanal;2-phenyloxirane;4-phenyl-2-propyl-1,3-dioxolane |
| SMILES | CCCC1OCC(c2ccccc2)O1.CCCC=O.c1ccc(C2CO2)cc1 |
| InChI | InChI=1S/C12H16O2.C8H8O.C4H8O/c1-2-6-12-13-9-11(14-12)10-7-4-3-5-8-10;1-2-4-7(5-3-1)8-6-9-8;1-2-3-4-5/h3-5,7-8,11-12H,2,6,9H2,1H3;1-5,8H,6H2;4H,2-3H2,1H3 |
| InChIKey | FVGMIAQYYQHKHL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|