C11H14FNO2 — CID 82158506
2-[4-(4-fluorophenyl)-1,3-dioxolan-2-yl]ethanamine (PubChem CID 82158506) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-1,3-dioxolan-2-yl]ethanamine.
| Compound Name | 2-[4-(4-fluorophenyl)-1,3-dioxolan-2-yl]ethanamine |
|---|---|
| PubChem CID | 82158506 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-1,3-dioxolan-2-yl]ethanamine |
| SMILES | NCCC1OCC(c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C11H14FNO2/c12-9-3-1-8(2-4-9)10-7-14-11(15-10)5-6-13/h1-4,10-11H,5-7,13H2 |
| InChIKey | ZGKUFVADEMJOJB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |