C10H12FNO2 — CID 82158224
[4-(2-fluorophenyl)-1,3-dioxolan-2-yl]methanamine (PubChem CID 82158224) has the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. Its IUPAC name is [4-(2-fluorophenyl)-1,3-dioxolan-2-yl]methanamine.
| Compound Name | [4-(2-fluorophenyl)-1,3-dioxolan-2-yl]methanamine |
|---|---|
| PubChem CID | 82158224 |
| Molecular Formula | C10H12FNO2 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | [4-(2-fluorophenyl)-1,3-dioxolan-2-yl]methanamine |
| SMILES | NCC1OCC(c2ccccc2F)O1 |
| InChI | InChI=1S/C10H12FNO2/c11-8-4-2-1-3-7(8)9-6-13-10(5-12)14-9/h1-4,9-10H,5-6,12H2 |
| InChIKey | SPEOIGDDWAUYIB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |